C22H21N3O3 — CID 90549371
3-(2-methoxyphenyl)-N-[3-(2-methoxyphenyl)prop-2-ynyl]-1-methylpyrazole-5-carboxamide (PubChem CID 90549371) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-N-[3-(2-methoxyphenyl)prop-2-ynyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 3-(2-methoxyphenyl)-N-[3-(2-methoxyphenyl)prop-2-ynyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90549371 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-(2-methoxyphenyl)-N-[3-(2-methoxyphenyl)prop-2-ynyl]-1-methylpyrazole-5-carboxamide |
| SMILES | COc1ccccc1C#CCNC(=O)c1cc(-c2ccccc2OC)nn1C |
| InChI | InChI=1S/C22H21N3O3/c1-25-19(15-18(24-25)17-11-5-7-13-21(17)28-3)22(26)23-14-8-10-16-9-4-6-12-20(16)27-2/h4-7,9,11-13,15H,14H2,1-3H3,(H,23,26) |
| InChIKey | SGQJRFDAPNNZHD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|