C23H24N4O4 — CID 90579434
3-(2,5-dimethoxyphenyl)-1-methyl-N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]pyrazole-5-carboxamide (PubChem CID 90579434) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-1-methyl-N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]pyrazole-5-carboxamide.
| Compound Name | 3-(2,5-dimethoxyphenyl)-1-methyl-N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90579434 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-1-methyl-N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]pyrazole-5-carboxamide |
| SMILES | COc1ccc(OC)c(-c2cc(C(=O)NCC#CCOc3ccc(C)nc3)n(C)n2)c1 |
| InChI | InChI=1S/C23H24N4O4/c1-16-7-8-18(15-25-16)31-12-6-5-11-24-23(28)21-14-20(26-27(21)2)19-13-17(29-3)9-10-22(19)30-4/h7-10,13-15H,11-12H2,1-4H3,(H,24,28) |
| InChIKey | XTDGEKAMPWUECV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|