C26H23ClFN3O — CID 42755212
1-(3-chlorophenyl)-3-(4-fluorophenyl)-N-(4-phenylbutan-2-yl)pyrazole-5-carboxamide (PubChem CID 42755212) has the molecular formula C26H23ClFN3O and a molecular weight of 447.94 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(4-fluorophenyl)-N-(4-phenylbutan-2-yl)pyrazole-5-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-3-(4-fluorophenyl)-N-(4-phenylbutan-2-yl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42755212 |
| Molecular Formula | C26H23ClFN3O |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(4-fluorophenyl)-N-(4-phenylbutan-2-yl)pyrazole-5-carboxamide |
| SMILES | CC(CCc1ccccc1)NC(=O)c1cc(-c2ccc(F)cc2)nn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H23ClFN3O/c1-18(10-11-19-6-3-2-4-7-19)29-26(32)25-17-24(20-12-14-22(28)15-13-20)30-31(25)23-9-5-8-21(27)16-23/h2-9,12-18H,10-11H2,1H3,(H,29,32) |
| InChIKey | CSSILKSFILOUSO-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |