C27H26FN3O2 — CID 42754820
3-(2-fluorophenyl)-1-(4-methoxyphenyl)-N-(4-phenylbutan-2-yl)pyrazole-5-carboxamide (PubChem CID 42754820) has the molecular formula C27H26FN3O2 and a molecular weight of 443.52 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-(4-methoxyphenyl)-N-(4-phenylbutan-2-yl)pyrazole-5-carboxamide.
| Compound Name | 3-(2-fluorophenyl)-1-(4-methoxyphenyl)-N-(4-phenylbutan-2-yl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42754820 |
| Molecular Formula | C27H26FN3O2 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 3-(2-fluorophenyl)-1-(4-methoxyphenyl)-N-(4-phenylbutan-2-yl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-n2nc(-c3ccccc3F)cc2C(=O)NC(C)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H26FN3O2/c1-19(12-13-20-8-4-3-5-9-20)29-27(32)26-18-25(23-10-6-7-11-24(23)28)30-31(26)21-14-16-22(33-2)17-15-21/h3-11,14-19H,12-13H2,1-2H3,(H,29,32) |
| InChIKey | HKFQJHHEEJQMQV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |