C18H30O2 — CID 22501514
2-[2,5-bis(2-methylbutan-2-yl)phenoxy]ethanol (PubChem CID 22501514) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-[2,5-bis(2-methylbutan-2-yl)phenoxy]ethanol.
| Compound Name | 2-[2,5-bis(2-methylbutan-2-yl)phenoxy]ethanol |
|---|---|
| PubChem CID | 22501514 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 2-[2,5-bis(2-methylbutan-2-yl)phenoxy]ethanol |
| SMILES | CCC(C)(C)c1ccc(C(C)(C)CC)c(OCCO)c1 |
| InChI | InChI=1S/C18H30O2/c1-7-17(3,4)14-9-10-15(18(5,6)8-2)16(13-14)20-12-11-19/h9-10,13,19H,7-8,11-12H2,1-6H3 |
| InChIKey | ADUIALQGPNGZGC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |