C24H34N4O2 — CID 143030582
2-[4-butan-2-yl-2-(2-methylbutan-2-yl)phenoxy]-N-(6-cyanopyridazin-3-yl)acetamide;ethane (PubChem CID 143030582) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-[4-butan-2-yl-2-(2-methylbutan-2-yl)phenoxy]-N-(6-cyanopyridazin-3-yl)acetamide;ethane.
| Compound Name | 2-[4-butan-2-yl-2-(2-methylbutan-2-yl)phenoxy]-N-(6-cyanopyridazin-3-yl)acetamide;ethane |
|---|---|
| PubChem CID | 143030582 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 2-[4-butan-2-yl-2-(2-methylbutan-2-yl)phenoxy]-N-(6-cyanopyridazin-3-yl)acetamide;ethane |
| SMILES | CC.CCC(C)c1ccc(OCC(=O)Nc2ccc(C#N)nn2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C22H28N4O2.C2H6/c1-6-15(3)16-8-10-19(18(12-16)22(4,5)7-2)28-14-21(27)24-20-11-9-17(13-23)25-26-20;1-2/h8-12,15H,6-7,14H2,1-5H3,(H,24,26,27);1-2H3 |
| InChIKey | NYDMMHNWIUUPOB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |