C15H20N2O3S — CID 110326306
N-[2-(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]ethanesulfonamide (PubChem CID 110326306) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is N-[2-(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]ethanesulfonamide.
| Compound Name | N-[2-(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 110326306 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-[2-(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCc1cc2cc(C)cc(C)c2[nH]c1=O |
| InChI | InChI=1S/C15H20N2O3S/c1-4-21(19,20)16-6-5-12-9-13-8-10(2)7-11(3)14(13)17-15(12)18/h7-9,16H,4-6H2,1-3H3,(H,17,18) |
| InChIKey | GRIOGHJJGNYBIK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |