C16H22N2O3S — CID 110325324
N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]butane-1-sulfonamide (PubChem CID 110325324) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]butane-1-sulfonamide.
| Compound Name | N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 110325324 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCc1cc2cc(C)cc(C)c2[nH]c1=O |
| InChI | InChI=1S/C16H22N2O3S/c1-4-5-6-22(20,21)17-10-14-9-13-8-11(2)7-12(3)15(13)18-16(14)19/h7-9,17H,4-6,10H2,1-3H3,(H,18,19) |
| InChIKey | AALICRAMDPQEOY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |