C15H14FN5O8S — CID 3094128
ethyl 2-[(4-fluoro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-nitrobenzoate (PubChem CID 3094128) has the molecular formula C15H14FN5O8S and a molecular weight of 443.37 g/mol. Its IUPAC name is ethyl 2-[(4-fluoro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-nitrobenzoate.
| Compound Name | ethyl 2-[(4-fluoro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-nitrobenzoate |
|---|---|
| PubChem CID | 3094128 |
| Molecular Formula | C15H14FN5O8S |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | ethyl 2-[(4-fluoro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-nitrobenzoate |
| SMILES | CCOC(=O)c1ccc([N+](=O)[O-])cc1S(=O)(=O)NC(=O)Nc1nc(F)cc(OC)n1 |
| InChI | InChI=1S/C15H14FN5O8S/c1-3-29-13(22)9-5-4-8(21(24)25)6-10(9)30(26,27)20-15(23)19-14-17-11(16)7-12(18-14)28-2/h4-7H,3H2,1-2H3,(H2,17,18,19,20,23) |
| InChIKey | BGZNMRNWNNKLOU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 179.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|