C16H18N4O7S — CID 87832395
1-(4,6-dimethoxypyrimidin-2-yl)-3-sulfonylurea;methyl 2-methylbenzoate (PubChem CID 87832395) has the molecular formula C16H18N4O7S and a molecular weight of 410.41 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-3-sulfonylurea;methyl 2-methylbenzoate.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-sulfonylurea;methyl 2-methylbenzoate |
|---|---|
| PubChem CID | 87832395 |
| Molecular Formula | C16H18N4O7S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-sulfonylurea;methyl 2-methylbenzoate |
| SMILES | COC(=O)c1ccccc1C.COc1cc(OC)nc(NC(=O)N=S(=O)=O)n1 |
| InChI | InChI=1S/C9H10O2.C7H8N4O5S/c1-7-5-3-4-6-8(7)9(10)11-2;1-15-4-3-5(16-2)9-6(8-4)10-7(12)11-17(13)14/h3-6H,1-2H3;3H,1-2H3,(H,8,9,10,12) |
| InChIKey | ZQNKWJYHEZUZKY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 146.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |