C15H14F2N4O7S — CID 88664683
1-[4-(difluoromethoxy)-6-methoxypyrimidin-2-yl]-3-sulfonylurea;methyl benzoate (PubChem CID 88664683) has the molecular formula C15H14F2N4O7S and a molecular weight of 432.36 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)-6-methoxypyrimidin-2-yl]-3-sulfonylurea;methyl benzoate.
| Compound Name | 1-[4-(difluoromethoxy)-6-methoxypyrimidin-2-yl]-3-sulfonylurea;methyl benzoate |
|---|---|
| PubChem CID | 88664683 |
| Molecular Formula | C15H14F2N4O7S |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 1-[4-(difluoromethoxy)-6-methoxypyrimidin-2-yl]-3-sulfonylurea;methyl benzoate |
| SMILES | COC(=O)c1ccccc1.COc1cc(OC(F)F)nc(NC(=O)N=S(=O)=O)n1 |
| InChI | InChI=1S/C8H8O2.C7H6F2N4O5S/c1-10-8(9)7-5-3-2-4-6-7;1-17-3-2-4(18-5(8)9)11-6(10-3)12-7(14)13-19(15)16/h2-6H,1H3;2,5H,1H3,(H,10,11,12,14) |
| InChIKey | ALEBJFMEDAXHHD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 146.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |