C15H12F4N4O7S — CID 141199280
methyl 2-[[4,6-bis(difluoromethoxy)pyrimidin-2-yl]carbamoylsulfonylamino]benzoate (PubChem CID 141199280) has the molecular formula C15H12F4N4O7S and a molecular weight of 468.34 g/mol. Its IUPAC name is methyl 2-[[4,6-bis(difluoromethoxy)pyrimidin-2-yl]carbamoylsulfonylamino]benzoate.
| Compound Name | methyl 2-[[4,6-bis(difluoromethoxy)pyrimidin-2-yl]carbamoylsulfonylamino]benzoate |
|---|---|
| PubChem CID | 141199280 |
| Molecular Formula | C15H12F4N4O7S |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | methyl 2-[[4,6-bis(difluoromethoxy)pyrimidin-2-yl]carbamoylsulfonylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NS(=O)(=O)C(=O)Nc1nc(OC(F)F)cc(OC(F)F)n1 |
| InChI | InChI=1S/C15H12F4N4O7S/c1-28-11(24)7-4-2-3-5-8(7)23-31(26,27)15(25)22-14-20-9(29-12(16)17)6-10(21-14)30-13(18)19/h2-6,12-13,23H,1H3,(H,20,21,22,25) |
| InChIKey | POPQKEWOTAPQPN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|