C18H23F3N6O5S — CID 88521984
ethyl 2-[[[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]methylsulfamoyl]-3-methylbenzoate (PubChem CID 88521984) has the molecular formula C18H23F3N6O5S and a molecular weight of 492.48 g/mol. Its IUPAC name is ethyl 2-[[[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]methylsulfamoyl]-3-methylbenzoate.
| Compound Name | ethyl 2-[[[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]methylsulfamoyl]-3-methylbenzoate |
|---|---|
| PubChem CID | 88521984 |
| Molecular Formula | C18H23F3N6O5S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | ethyl 2-[[[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]methylsulfamoyl]-3-methylbenzoate |
| SMILES | CCOC(=O)c1cccc(C)c1S(=O)(=O)NCNc1nc(OCC(F)(F)F)nc(N(C)C)n1 |
| InChI | InChI=1S/C18H23F3N6O5S/c1-5-31-14(28)12-8-6-7-11(2)13(12)33(29,30)23-10-22-15-24-16(27(3)4)26-17(25-15)32-9-18(19,20)21/h6-8,23H,5,9-10H2,1-4H3,(H,22,24,25,26) |
| InChIKey | BJGQGADIIXSUOQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|