C15H14ClN5O5S — CID 67617684
1-[[4-(2-chloroethynyl)phenyl]sulfamoyl]-3-(4,6-dimethoxypyrimidin-2-yl)urea (PubChem CID 67617684) has the molecular formula C15H14ClN5O5S and a molecular weight of 411.83 g/mol. Its IUPAC name is 1-[[4-(2-chloroethynyl)phenyl]sulfamoyl]-3-(4,6-dimethoxypyrimidin-2-yl)urea.
| Compound Name | 1-[[4-(2-chloroethynyl)phenyl]sulfamoyl]-3-(4,6-dimethoxypyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 67617684 |
| Molecular Formula | C15H14ClN5O5S |
| Molecular Weight | 411.83 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 1-[[4-(2-chloroethynyl)phenyl]sulfamoyl]-3-(4,6-dimethoxypyrimidin-2-yl)urea |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)Nc2ccc(C#CCl)cc2)n1 |
| InChI | InChI=1S/C15H14ClN5O5S/c1-25-12-9-13(26-2)18-14(17-12)19-15(22)21-27(23,24)20-11-5-3-10(4-6-11)7-8-16/h3-6,9,20H,1-2H3,(H2,17,18,19,21,22) |
| InChIKey | RXFDTPGSRFSKIL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.83 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|