C13H16N6O7S — CID 21478088
1-(4,6-dimethoxypyrimidin-2-yl)-3-[(3,4-dimethyl-2,5-dioxopyrrol-1-yl)sulfamoyl]urea (PubChem CID 21478088) has the molecular formula C13H16N6O7S and a molecular weight of 400.37 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-3-[(3,4-dimethyl-2,5-dioxopyrrol-1-yl)sulfamoyl]urea.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-[(3,4-dimethyl-2,5-dioxopyrrol-1-yl)sulfamoyl]urea |
|---|---|
| PubChem CID | 21478088 |
| Molecular Formula | C13H16N6O7S |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-[(3,4-dimethyl-2,5-dioxopyrrol-1-yl)sulfamoyl]urea |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)NN2C(=O)C(C)=C(C)C2=O)n1 |
| InChI | InChI=1S/C13H16N6O7S/c1-6-7(2)11(21)19(10(6)20)18-27(23,24)17-13(22)16-12-14-8(25-3)5-9(15-12)26-4/h5,18H,1-4H3,(H2,14,15,16,17,22) |
| InChIKey | OFNXZNOBCALDNI-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 168.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|