C13H15N5O6S — CID 19866062
1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-methyl-1-oxidopyridin-1-ium-2-yl)sulfonylurea (PubChem CID 19866062) has the molecular formula C13H15N5O6S and a molecular weight of 369.36 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-methyl-1-oxidopyridin-1-ium-2-yl)sulfonylurea.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-methyl-1-oxidopyridin-1-ium-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 19866062 |
| Molecular Formula | C13H15N5O6S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-methyl-1-oxidopyridin-1-ium-2-yl)sulfonylurea |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2c(C)ccc[n+]2[O-])n1 |
| InChI | InChI=1S/C13H15N5O6S/c1-8-5-4-6-18(20)11(8)25(21,22)17-13(19)16-12-14-9(23-2)7-10(15-12)24-3/h4-7H,1-3H3,(H2,14,15,16,17,19) |
| InChIKey | FEJCLMWJSUENSM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 146.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|