C12H10F2N2O4S2 — CID 75526090
3,4-difluoro-N-(2-sulfamoylphenyl)benzenesulfonamide (PubChem CID 75526090) has the molecular formula C12H10F2N2O4S2 and a molecular weight of 348.35 g/mol. Its IUPAC name is 3,4-difluoro-N-(2-sulfamoylphenyl)benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-(2-sulfamoylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 75526090 |
| Molecular Formula | C12H10F2N2O4S2 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 3,4-difluoro-N-(2-sulfamoylphenyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1NS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H10F2N2O4S2/c13-9-6-5-8(7-10(9)14)22(19,20)16-11-3-1-2-4-12(11)21(15,17)18/h1-7,16H,(H2,15,17,18) |
| InChIKey | IGMAJVLVLONPOH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |