C12H11N3O6S2 — CID 68782623
2-[(4-nitrophenyl)sulfonylamino]benzenesulfonamide (PubChem CID 68782623) has the molecular formula C12H11N3O6S2 and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | 2-[(4-nitrophenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 68782623 |
| Molecular Formula | C12H11N3O6S2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 2-[(4-nitrophenyl)sulfonylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H11N3O6S2/c13-22(18,19)12-4-2-1-3-11(12)14-23(20,21)10-7-5-9(6-8-10)15(16)17/h1-8,14H,(H2,13,18,19) |
| InChIKey | PCWVGEPALSDKRK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|