C14H15ClN2O5S2 — CID 24629158
2-chloro-N-(4-methoxy-3-sulfamoylphenyl)-4-methylbenzenesulfonamide (PubChem CID 24629158) has the molecular formula C14H15ClN2O5S2 and a molecular weight of 390.87 g/mol. Its IUPAC name is 2-chloro-N-(4-methoxy-3-sulfamoylphenyl)-4-methylbenzenesulfonamide.
| Compound Name | 2-chloro-N-(4-methoxy-3-sulfamoylphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 24629158 |
| Molecular Formula | C14H15ClN2O5S2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 2-chloro-N-(4-methoxy-3-sulfamoylphenyl)-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C)cc2Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H15ClN2O5S2/c1-9-3-6-13(11(15)7-9)24(20,21)17-10-4-5-12(22-2)14(8-10)23(16,18)19/h3-8,17H,1-2H3,(H2,16,18,19) |
| InChIKey | TTXGKLSFETTWOB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |