C14H12BN3O6S — CID 88555141
CID 88555141 (PubChem CID 88555141) has the molecular formula C14H12BN3O6S and a molecular weight of 361.14 g/mol.
| Compound Name | CID 88555141 |
|---|---|
| PubChem CID | 88555141 |
| Molecular Formula | C14H12BN3O6S |
| Molecular Weight | 361.14 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)Nc2ccc(S(N)(=O)=O)c(OC)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12BN3O6S/c1-24-12-7-9(3-5-13(12)25(16,22)23)17-14(19)8-2-4-10(15)11(6-8)18(20)21/h2-7H,1H3,(H,17,19)(H2,16,22,23) |
| InChIKey | NCSIZEQGGMNFBR-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.14 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|