C6H5Cl2NO — CID 18942828
N-(2,3-dichlorophenyl)hydroxylamine (PubChem CID 18942828) has the molecular formula C6H5Cl2NO and a molecular weight of 178.02 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)hydroxylamine.
| Compound Name | N-(2,3-dichlorophenyl)hydroxylamine |
|---|---|
| PubChem CID | 18942828 |
| Molecular Formula | C6H5Cl2NO |
| Molecular Weight | 178.02 g/mol |
| Exact Mass | 176.97 |
| IUPAC Name | N-(2,3-dichlorophenyl)hydroxylamine |
| SMILES | ONc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C6H5Cl2NO/c7-4-2-1-3-5(9-10)6(4)8/h1-3,9-10H |
| InChIKey | IARNXGGKYDPYTB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.02 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|