C9H7Cl4N — CID 79167531
2,3-dichloro-N-(2,3-dichloroprop-2-enyl)aniline (PubChem CID 79167531) has the molecular formula C9H7Cl4N and a molecular weight of 270.97 g/mol. Its IUPAC name is 2,3-dichloro-N-(2,3-dichloroprop-2-enyl)aniline.
| Compound Name | 2,3-dichloro-N-(2,3-dichloroprop-2-enyl)aniline |
|---|---|
| PubChem CID | 79167531 |
| Molecular Formula | C9H7Cl4N |
| Molecular Weight | 270.97 g/mol |
| Exact Mass | 268.93 |
| IUPAC Name | 2,3-dichloro-N-(2,3-dichloroprop-2-enyl)aniline |
| SMILES | ClC=C(Cl)CNc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H7Cl4N/c10-4-6(11)5-14-8-3-1-2-7(12)9(8)13/h1-4,14H,5H2 |
| InChIKey | PAMUJMHWSOPRPJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.97 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |