C7H9Cl2NO6P2 — CID 24866779
[(2,3-dichloroanilino)-phosphonomethyl]phosphonic acid (PubChem CID 24866779) has the molecular formula C7H9Cl2NO6P2 and a molecular weight of 336.00 g/mol. Its IUPAC name is [(2,3-dichloroanilino)-phosphonomethyl]phosphonic acid.
| Compound Name | [(2,3-dichloroanilino)-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 24866779 |
| Molecular Formula | C7H9Cl2NO6P2 |
| Molecular Weight | 336.00 g/mol |
| Exact Mass | 334.93 |
| IUPAC Name | [(2,3-dichloroanilino)-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Nc1cccc(Cl)c1Cl)P(=O)(O)O |
| InChI | InChI=1S/C7H9Cl2NO6P2/c8-4-2-1-3-5(6(4)9)10-7(17(11,12)13)18(14,15)16/h1-3,7,10H,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | MHZIAHXWTPYINE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.00 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|