C18H14Cl2NO3P — CID 2285507
2,3-dichloro-N-diphenoxyphosphorylaniline (PubChem CID 2285507) has the molecular formula C18H14Cl2NO3P and a molecular weight of 394.19 g/mol. Its IUPAC name is 2,3-dichloro-N-diphenoxyphosphorylaniline.
| Compound Name | 2,3-dichloro-N-diphenoxyphosphorylaniline |
|---|---|
| PubChem CID | 2285507 |
| Molecular Formula | C18H14Cl2NO3P |
| Molecular Weight | 394.19 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 2,3-dichloro-N-diphenoxyphosphorylaniline |
| SMILES | O=P(Nc1cccc(Cl)c1Cl)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H14Cl2NO3P/c19-16-12-7-13-17(18(16)20)21-25(22,23-14-8-3-1-4-9-14)24-15-10-5-2-6-11-15/h1-13H,(H,21,22) |
| InChIKey | PFTLKSKQDDAINX-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.19 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|