C26H16Cl4N2O3 — CID 3396392
N-(2,3-dichlorophenyl)-4-[4-[(2,3-dichlorophenyl)carbamoyl]phenoxy]benzamide (PubChem CID 3396392) has the molecular formula C26H16Cl4N2O3 and a molecular weight of 546.24 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-4-[4-[(2,3-dichlorophenyl)carbamoyl]phenoxy]benzamide.
| Compound Name | N-(2,3-dichlorophenyl)-4-[4-[(2,3-dichlorophenyl)carbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 3396392 |
| Molecular Formula | C26H16Cl4N2O3 |
| Molecular Weight | 546.24 g/mol |
| Exact Mass | 543.99 |
| IUPAC Name | N-(2,3-dichlorophenyl)-4-[4-[(2,3-dichlorophenyl)carbamoyl]phenoxy]benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1ccc(Oc2ccc(C(=O)Nc3cccc(Cl)c3Cl)cc2)cc1 |
| InChI | InChI=1S/C26H16Cl4N2O3/c27-19-3-1-5-21(23(19)29)31-25(33)15-7-11-17(12-8-15)35-18-13-9-16(10-14-18)26(34)32-22-6-2-4-20(28)24(22)30/h1-14H,(H,31,33)(H,32,34) |
| InChIKey | GHRHXNDOKUKKFI-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.24 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |