C19H21Cl2NO3 — CID 12771069
4-(2-butoxyethoxy)-N-(2,3-dichlorophenyl)benzamide (PubChem CID 12771069) has the molecular formula C19H21Cl2NO3 and a molecular weight of 382.29 g/mol. Its IUPAC name is 4-(2-butoxyethoxy)-N-(2,3-dichlorophenyl)benzamide.
| Compound Name | 4-(2-butoxyethoxy)-N-(2,3-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 12771069 |
| Molecular Formula | C19H21Cl2NO3 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4-(2-butoxyethoxy)-N-(2,3-dichlorophenyl)benzamide |
| SMILES | CCCCOCCOc1ccc(C(=O)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C19H21Cl2NO3/c1-2-3-11-24-12-13-25-15-9-7-14(8-10-15)19(23)22-17-6-4-5-16(20)18(17)21/h4-10H,2-3,11-13H2,1H3,(H,22,23) |
| InChIKey | ORFSWKVCPFAPIR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|