C16H11Cl2NO2 — CID 78843025
N-(2,3-dichlorophenyl)-4-prop-2-ynoxybenzamide (PubChem CID 78843025) has the molecular formula C16H11Cl2NO2 and a molecular weight of 320.18 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-4-prop-2-ynoxybenzamide.
| Compound Name | N-(2,3-dichlorophenyl)-4-prop-2-ynoxybenzamide |
|---|---|
| PubChem CID | 78843025 |
| Molecular Formula | C16H11Cl2NO2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | N-(2,3-dichlorophenyl)-4-prop-2-ynoxybenzamide |
| SMILES | C#CCOc1ccc(C(=O)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H11Cl2NO2/c1-2-10-21-12-8-6-11(7-9-12)16(20)19-14-5-3-4-13(17)15(14)18/h1,3-9H,10H2,(H,19,20) |
| InChIKey | HDQKDTNBTHNTHV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|