C15H12Cl2N2O2 — CID 14883992
4-(2-amino-2-oxoethyl)-N-(2,3-dichlorophenyl)benzamide (PubChem CID 14883992) has the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethyl)-N-(2,3-dichlorophenyl)benzamide.
| Compound Name | 4-(2-amino-2-oxoethyl)-N-(2,3-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 14883992 |
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 4-(2-amino-2-oxoethyl)-N-(2,3-dichlorophenyl)benzamide |
| SMILES | NC(=O)Cc1ccc(C(=O)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C15H12Cl2N2O2/c16-11-2-1-3-12(14(11)17)19-15(21)10-6-4-9(5-7-10)8-13(18)20/h1-7H,8H2,(H2,18,20)(H,19,21) |
| InChIKey | HVMCEQAQPGVGQF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |