C19H23Cl2N — CID 54852650
2,3-dichloro-N-[2-[4-(2-methylpropyl)phenyl]propyl]aniline (PubChem CID 54852650) has the molecular formula C19H23Cl2N and a molecular weight of 336.31 g/mol. Its IUPAC name is 2,3-dichloro-N-[2-[4-(2-methylpropyl)phenyl]propyl]aniline.
| Compound Name | 2,3-dichloro-N-[2-[4-(2-methylpropyl)phenyl]propyl]aniline |
|---|---|
| PubChem CID | 54852650 |
| Molecular Formula | C19H23Cl2N |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2,3-dichloro-N-[2-[4-(2-methylpropyl)phenyl]propyl]aniline |
| SMILES | CC(C)Cc1ccc(C(C)CNc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C19H23Cl2N/c1-13(2)11-15-7-9-16(10-8-15)14(3)12-22-18-6-4-5-17(20)19(18)21/h4-10,13-14,22H,11-12H2,1-3H3 |
| InChIKey | FCBUKAHUTFJSRW-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |