C9H12ClFN2 — CID 164647580
N'-(2-chloro-3-fluorophenyl)propane-1,3-diamine (PubChem CID 164647580) has the molecular formula C9H12ClFN2 and a molecular weight of 202.66 g/mol. Its IUPAC name is N'-(2-chloro-3-fluorophenyl)propane-1,3-diamine.
| Compound Name | N'-(2-chloro-3-fluorophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 164647580 |
| Molecular Formula | C9H12ClFN2 |
| Molecular Weight | 202.66 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | N'-(2-chloro-3-fluorophenyl)propane-1,3-diamine |
| SMILES | NCCCNc1cccc(F)c1Cl |
| InChI | InChI=1S/C9H12ClFN2/c10-9-7(11)3-1-4-8(9)13-6-2-5-12/h1,3-4,13H,2,5-6,12H2 |
| InChIKey | FPAOFUCQTPPFRK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.66 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|