C12H17NO2 — CID 12999019
methyl 3-(2,5-dimethylanilino)propanoate (PubChem CID 12999019) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is methyl 3-(2,5-dimethylanilino)propanoate.
| Compound Name | methyl 3-(2,5-dimethylanilino)propanoate |
|---|---|
| PubChem CID | 12999019 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | methyl 3-(2,5-dimethylanilino)propanoate |
| SMILES | COC(=O)CCNc1cc(C)ccc1C |
| InChI | InChI=1S/C12H17NO2/c1-9-4-5-10(2)11(8-9)13-7-6-12(14)15-3/h4-5,8,13H,6-7H2,1-3H3 |
| InChIKey | BKUHYQUVMTXQPO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |