C12H18N2O — CID 103604085
N-[2-(2,5-dimethylanilino)ethyl]acetamide (PubChem CID 103604085) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-[2-(2,5-dimethylanilino)ethyl]acetamide.
| Compound Name | N-[2-(2,5-dimethylanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 103604085 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-[2-(2,5-dimethylanilino)ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(C)ccc1C |
| InChI | InChI=1S/C12H18N2O/c1-9-4-5-10(2)12(8-9)14-7-6-13-11(3)15/h4-5,8,14H,6-7H2,1-3H3,(H,13,15) |
| InChIKey | PSWQGNFKHKCWLX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|