C11H14F2N2O — CID 107530150
N-[2-(2,5-difluoro-4-methylanilino)ethyl]acetamide (PubChem CID 107530150) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is N-[2-(2,5-difluoro-4-methylanilino)ethyl]acetamide.
| Compound Name | N-[2-(2,5-difluoro-4-methylanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 107530150 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | N-[2-(2,5-difluoro-4-methylanilino)ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(F)c(C)cc1F |
| InChI | InChI=1S/C11H14F2N2O/c1-7-5-10(13)11(6-9(7)12)15-4-3-14-8(2)16/h5-6,15H,3-4H2,1-2H3,(H,14,16) |
| InChIKey | RKNHWZFCYUCHNC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|