C13H19F2N — CID 103585744
2,5-difluoro-4-methyl-N-(4-methylpentyl)aniline (PubChem CID 103585744) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is 2,5-difluoro-4-methyl-N-(4-methylpentyl)aniline.
| Compound Name | 2,5-difluoro-4-methyl-N-(4-methylpentyl)aniline |
|---|---|
| PubChem CID | 103585744 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2,5-difluoro-4-methyl-N-(4-methylpentyl)aniline |
| SMILES | Cc1cc(F)c(NCCCC(C)C)cc1F |
| InChI | InChI=1S/C13H19F2N/c1-9(2)5-4-6-16-13-8-11(14)10(3)7-12(13)15/h7-9,16H,4-6H2,1-3H3 |
| InChIKey | BZNLLJABHTTYFS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|