C12H17F2NS — CID 103585178
2,5-difluoro-4-methyl-N-(4-methylsulfanylbutyl)aniline (PubChem CID 103585178) has the molecular formula C12H17F2NS and a molecular weight of 245.34 g/mol. Its IUPAC name is 2,5-difluoro-4-methyl-N-(4-methylsulfanylbutyl)aniline.
| Compound Name | 2,5-difluoro-4-methyl-N-(4-methylsulfanylbutyl)aniline |
|---|---|
| PubChem CID | 103585178 |
| Molecular Formula | C12H17F2NS |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2,5-difluoro-4-methyl-N-(4-methylsulfanylbutyl)aniline |
| SMILES | CSCCCCNc1cc(F)c(C)cc1F |
| InChI | InChI=1S/C12H17F2NS/c1-9-7-11(14)12(8-10(9)13)15-5-3-4-6-16-2/h7-8,15H,3-6H2,1-2H3 |
| InChIKey | RNVGOPODHLRRIL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|