C16H23O4S+ — CID 11015984
(2,5-dimethylphenyl)-bis(3-methoxy-3-oxopropyl)sulfanium (PubChem CID 11015984) has the molecular formula C16H23O4S+ and a molecular weight of 311.42 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-bis(3-methoxy-3-oxopropyl)sulfanium.
| Compound Name | (2,5-dimethylphenyl)-bis(3-methoxy-3-oxopropyl)sulfanium |
|---|---|
| PubChem CID | 11015984 |
| Molecular Formula | C16H23O4S+ |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (2,5-dimethylphenyl)-bis(3-methoxy-3-oxopropyl)sulfanium |
| SMILES | COC(=O)CC[S+](CCC(=O)OC)c1cc(C)ccc1C |
| InChI | InChI=1S/C16H23O4S/c1-12-5-6-13(2)14(11-12)21(9-7-15(17)19-3)10-8-16(18)20-4/h5-6,11H,7-10H2,1-4H3/q+1 |
| InChIKey | NWAIAUDTNDPEFQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|