C19H31FO6 — CID 142876062
2-fluoro-1,4-dimethylbenzene;methyl 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate (PubChem CID 142876062) has the molecular formula C19H31FO6 and a molecular weight of 374.45 g/mol. Its IUPAC name is 2-fluoro-1,4-dimethylbenzene;methyl 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate.
| Compound Name | 2-fluoro-1,4-dimethylbenzene;methyl 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 142876062 |
| Molecular Formula | C19H31FO6 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2-fluoro-1,4-dimethylbenzene;methyl 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate |
| SMILES | COCCOCCOCCOCCC(=O)OC.Cc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C11H22O6.C8H9F/c1-13-5-6-16-9-10-17-8-7-15-4-3-11(12)14-2;1-6-3-4-7(2)8(9)5-6/h3-10H2,1-2H3;3-5H,1-2H3 |
| InChIKey | GTGVXWBDWGMNRD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|