C19H27FO7 — CID 142875989
(2-fluoro-4-methylphenyl) 3-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 142875989) has the molecular formula C19H27FO7 and a molecular weight of 386.42 g/mol. Its IUPAC name is (2-fluoro-4-methylphenyl) 3-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2-fluoro-4-methylphenyl) 3-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 142875989 |
| Molecular Formula | C19H27FO7 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (2-fluoro-4-methylphenyl) 3-[2-[2-[2-(3-oxopropoxy)ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | Cc1ccc(OC(=O)CCOCCOCCOCCOCCC=O)c(F)c1 |
| InChI | InChI=1S/C19H27FO7/c1-16-3-4-18(17(20)15-16)27-19(22)5-8-24-10-12-26-14-13-25-11-9-23-7-2-6-21/h3-4,6,15H,2,5,7-14H2,1H3 |
| InChIKey | HGYODQGTBUXGOF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|