C11H23N3O2SSi — CID 102400167
ethyl (2Z)-2-(carbamothioylhydrazinylidene)-2-triethylsilylacetate (PubChem CID 102400167) has the molecular formula C11H23N3O2SSi and a molecular weight of 289.48 g/mol. Its IUPAC name is ethyl (2Z)-2-(carbamothioylhydrazinylidene)-2-triethylsilylacetate.
| Compound Name | ethyl (2Z)-2-(carbamothioylhydrazinylidene)-2-triethylsilylacetate |
|---|---|
| PubChem CID | 102400167 |
| Molecular Formula | C11H23N3O2SSi |
| Molecular Weight | 289.48 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | ethyl (2Z)-2-(carbamothioylhydrazinylidene)-2-triethylsilylacetate |
| SMILES | CCOC(=O)/C(=N/NC(N)=S)[Si](CC)(CC)CC |
| InChI | InChI=1S/C11H23N3O2SSi/c1-5-16-10(15)9(13-14-11(12)17)18(6-2,7-3)8-4/h5-8H2,1-4H3,(H3,12,14,17)/b13-9- |
| InChIKey | RHFJAZKZIGYFGX-LCYFTJDESA-N |
| XLogP | 1.79 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|