C18H19ClF3N3O5S — CID 20610346
(2R)-N-[4-[(4-aminophenyl)-(2-hydroxyethyl)sulfamoyl]-2-chlorophenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide (PubChem CID 20610346) has the molecular formula C18H19ClF3N3O5S and a molecular weight of 481.88 g/mol. Its IUPAC name is (2R)-N-[4-[(4-aminophenyl)-(2-hydroxyethyl)sulfamoyl]-2-chlorophenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide.
| Compound Name | (2R)-N-[4-[(4-aminophenyl)-(2-hydroxyethyl)sulfamoyl]-2-chlorophenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 20610346 |
| Molecular Formula | C18H19ClF3N3O5S |
| Molecular Weight | 481.88 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | (2R)-N-[4-[(4-aminophenyl)-(2-hydroxyethyl)sulfamoyl]-2-chlorophenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide |
| SMILES | C[C@@](O)(C(=O)Nc1ccc(S(=O)(=O)N(CCO)c2ccc(N)cc2)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C18H19ClF3N3O5S/c1-17(28,18(20,21)22)16(27)24-15-7-6-13(10-14(15)19)31(29,30)25(8-9-26)12-4-2-11(23)3-5-12/h2-7,10,26,28H,8-9,23H2,1H3,(H,24,27)/t17-/m1/s1 |
| InChIKey | DYDLVKHJGMHAEW-QGZVFWFLSA-N |
| XLogP | 2.36 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.88 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|