C17H25ClF3N3O4S — CID 10813808
(2R)-N-[2-chloro-4-[3-(diethylamino)propylsulfamoyl]phenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide (PubChem CID 10813808) has the molecular formula C17H25ClF3N3O4S and a molecular weight of 459.92 g/mol. Its IUPAC name is (2R)-N-[2-chloro-4-[3-(diethylamino)propylsulfamoyl]phenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide.
| Compound Name | (2R)-N-[2-chloro-4-[3-(diethylamino)propylsulfamoyl]phenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 10813808 |
| Molecular Formula | C17H25ClF3N3O4S |
| Molecular Weight | 459.92 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (2R)-N-[2-chloro-4-[3-(diethylamino)propylsulfamoyl]phenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide |
| SMILES | CCN(CC)CCCNS(=O)(=O)c1ccc(NC(=O)[C@@](C)(O)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C17H25ClF3N3O4S/c1-4-24(5-2)10-6-9-22-29(27,28)12-7-8-14(13(18)11-12)23-15(25)16(3,26)17(19,20)21/h7-8,11,22,26H,4-6,9-10H2,1-3H3,(H,23,25)/t16-/m1/s1 |
| InChIKey | XRMAIQZIMRILDM-MRXNPFEDSA-N |
| XLogP | 2.60 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.92 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|