C16H7ClF17NO3 — CID 4102745
N-(5-chloro-2-methylphenyl)-2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanamide (PubChem CID 4102745) has the molecular formula C16H7ClF17NO3 and a molecular weight of 619.65 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanamide |
|---|---|
| PubChem CID | 4102745 |
| Molecular Formula | C16H7ClF17NO3 |
| Molecular Weight | 619.65 g/mol |
| Exact Mass | 618.98 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H7ClF17NO3/c1-5-2-3-6(17)4-7(5)35-8(36)9(18,12(22,23)24)37-16(33,34)11(21,14(28,29)30)38-15(31,32)10(19,20)13(25,26)27/h2-4H,1H3,(H,35,36) |
| InChIKey | PUBDMUWYTJFADA-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.65 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|