C11H3F17N4O3 — CID 163144474
(2S)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(1,2,4-triazol-4-yl)propanamide (PubChem CID 163144474) has the molecular formula C11H3F17N4O3 and a molecular weight of 562.14 g/mol. Its IUPAC name is (2S)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(1,2,4-triazol-4-yl)propanamide.
| Compound Name | (2S)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 163144474 |
| Molecular Formula | C11H3F17N4O3 |
| Molecular Weight | 562.14 g/mol |
| Exact Mass | 561.99 |
| IUPAC Name | (2S)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(1,2,4-triazol-4-yl)propanamide |
| SMILES | O=C(Nn1cnnc1)[C@@](F)(OC(F)(F)[C@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H3F17N4O3/c12-4(7(16,17)18,3(33)31-32-1-29-30-2-32)34-11(27,28)6(15,9(22,23)24)35-10(25,26)5(13,14)8(19,20)21/h1-2H,(H,31,33)/t4-,6-/m1/s1 |
| InChIKey | LAAHWGHCSUMQHD-INEUFUBQSA-N |
| XLogP | 4.22 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.14 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|