C12H3F17N2O3S — CID 163079215
(2R)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 163079215) has the molecular formula C12H3F17N2O3S and a molecular weight of 578.20 g/mol. Its IUPAC name is (2R)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | (2R)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 163079215 |
| Molecular Formula | C12H3F17N2O3S |
| Molecular Weight | 578.20 g/mol |
| Exact Mass | 577.96 |
| IUPAC Name | (2R)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(Nc1nccs1)[C@](F)(OC(F)(F)[C@@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H3F17N2O3S/c13-5(8(17,18)19,3(32)31-4-30-1-2-35-4)33-12(28,29)7(16,10(23,24)25)34-11(26,27)6(14,15)9(20,21)22/h1-2H,(H,30,31,32)/t5-,7-/m0/s1 |
| InChIKey | OHRZFHMJTCWFNY-FSPLSTOPSA-N |
| XLogP | 5.95 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.20 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|