C12H3Cl3F11NO2 — CID 71672259
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(2,4,6-trichlorophenyl)propanamide (PubChem CID 71672259) has the molecular formula C12H3Cl3F11NO2 and a molecular weight of 508.50 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(2,4,6-trichlorophenyl)propanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(2,4,6-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 71672259 |
| Molecular Formula | C12H3Cl3F11NO2 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 506.91 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(2,4,6-trichlorophenyl)propanamide |
| SMILES | O=C(Nc1c(Cl)cc(Cl)cc1Cl)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H3Cl3F11NO2/c13-3-1-4(14)6(5(15)2-3)27-7(28)8(16,10(19,20)21)29-12(25,26)9(17,18)11(22,23)24/h1-2H,(H,27,28) |
| InChIKey | QYQAKUDUFHTGQN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|