C11H5F11N2O2 — CID 2780518
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-pyridin-3-ylpropanamide (PubChem CID 2780518) has the molecular formula C11H5F11N2O2 and a molecular weight of 406.15 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-pyridin-3-ylpropanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 2780518 |
| Molecular Formula | C11H5F11N2O2 |
| Molecular Weight | 406.15 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-pyridin-3-ylpropanamide |
| SMILES | O=C(Nc1cccnc1)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H5F11N2O2/c12-7(9(15,16)17,6(25)24-5-2-1-3-23-4-5)26-11(21,22)8(13,14)10(18,19)20/h1-4H,(H,24,25) |
| InChIKey | AOSMRZDCNPKCTL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.15 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|