C17H8F17N3O3 — CID 99689362
(2S)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(1-methylbenzimidazol-2-yl)propanamide (PubChem CID 99689362) has the molecular formula C17H8F17N3O3 and a molecular weight of 625.24 g/mol. Its IUPAC name is (2S)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(1-methylbenzimidazol-2-yl)propanamide.
| Compound Name | (2S)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(1-methylbenzimidazol-2-yl)propanamide |
|---|---|
| PubChem CID | 99689362 |
| Molecular Formula | C17H8F17N3O3 |
| Molecular Weight | 625.24 g/mol |
| Exact Mass | 625.03 |
| IUPAC Name | (2S)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(1-methylbenzimidazol-2-yl)propanamide |
| SMILES | Cn1c(NC(=O)[C@@](F)(OC(F)(F)[C@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)nc2ccccc21 |
| InChI | InChI=1S/C17H8F17N3O3/c1-37-7-5-3-2-4-6(7)35-9(37)36-8(38)10(18,13(22,23)24)39-17(33,34)12(21,15(28,29)30)40-16(31,32)11(19,20)14(25,26)27/h2-5H,1H3,(H,35,36,38)/t10-,12-/m1/s1 |
| InChIKey | HXRUUQLDAKKLKH-ZYHUDNBSSA-N |
| XLogP | 6.38 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.24 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|