C10H5F7NiO3 — CID 54608465
4,4,5,5,6,6,6-heptafluoro-1-(furan-2-yl)hexane-1,3-dione;nickel (PubChem CID 54608465) has the molecular formula C10H5F7NiO3 and a molecular weight of 364.83 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-1-(furan-2-yl)hexane-1,3-dione;nickel.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-1-(furan-2-yl)hexane-1,3-dione;nickel |
|---|---|
| PubChem CID | 54608465 |
| Molecular Formula | C10H5F7NiO3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-1-(furan-2-yl)hexane-1,3-dione;nickel |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccco1.[Ni] |
| InChI | InChI=1S/C10H5F7O3.Ni/c11-8(12,9(13,14)10(15,16)17)7(19)4-5(18)6-2-1-3-20-6;/h1-3H,4H2; |
| InChIKey | MAJHZKBVGZLXIR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|