C16H9F7O2 — CID 86004327
4,4,5,5,6,6,6-heptafluoro-1-naphthalen-2-ylhexane-1,3-dione (PubChem CID 86004327) has the molecular formula C16H9F7O2 and a molecular weight of 366.23 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-1-naphthalen-2-ylhexane-1,3-dione.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-1-naphthalen-2-ylhexane-1,3-dione |
|---|---|
| PubChem CID | 86004327 |
| Molecular Formula | C16H9F7O2 |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-1-naphthalen-2-ylhexane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H9F7O2/c17-14(18,15(19,20)16(21,22)23)13(25)8-12(24)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2 |
| InChIKey | ZTQDJPADJMYCGV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|