C13H9F7O2 — CID 59099384
4,4,5,5,6,6,6-heptafluoro-1-(3-methylphenyl)hexane-1,3-dione (PubChem CID 59099384) has the molecular formula C13H9F7O2 and a molecular weight of 330.20 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-1-(3-methylphenyl)hexane-1,3-dione.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-1-(3-methylphenyl)hexane-1,3-dione |
|---|---|
| PubChem CID | 59099384 |
| Molecular Formula | C13H9F7O2 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-1-(3-methylphenyl)hexane-1,3-dione |
| SMILES | Cc1cccc(C(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H9F7O2/c1-7-3-2-4-8(5-7)9(21)6-10(22)11(14,15)12(16,17)13(18,19)20/h2-5H,6H2,1H3 |
| InChIKey | AEWVMPFFGAMLBN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|